C14H21FN2 — CID 168968934
4-[(2R)-2-amino-4,4-dimethylhex-5-enyl]-2-fluoroaniline (PubChem CID 168968934) has the molecular formula C14H21FN2 and a molecular weight of 236.33 g/mol. Its IUPAC name is 4-[(2R)-2-amino-4,4-dimethylhex-5-enyl]-2-fluoroaniline.
| Compound Name | 4-[(2R)-2-amino-4,4-dimethylhex-5-enyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 168968934 |
| Molecular Formula | C14H21FN2 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 4-[(2R)-2-amino-4,4-dimethylhex-5-enyl]-2-fluoroaniline |
| SMILES | C=CC(C)(C)C[C@@H](N)Cc1ccc(N)c(F)c1 |
| InChI | InChI=1S/C14H21FN2/c1-4-14(2,3)9-11(16)7-10-5-6-13(17)12(15)8-10/h4-6,8,11H,1,7,9,16-17H2,2-3H3/t11-/m0/s1 |
| InChIKey | XNQAEBLFGOCBKE-NSHDSACASA-N |
| XLogP | 2.88 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|