C9H11ClF4N2 — CID 117046713
4-(2-amino-3,3,3-trifluoropropyl)-2-fluoroaniline;hydrochloride (PubChem CID 117046713) has the molecular formula C9H11ClF4N2 and a molecular weight of 258.65 g/mol. Its IUPAC name is 4-(2-amino-3,3,3-trifluoropropyl)-2-fluoroaniline;hydrochloride.
| Compound Name | 4-(2-amino-3,3,3-trifluoropropyl)-2-fluoroaniline;hydrochloride |
|---|---|
| PubChem CID | 117046713 |
| Molecular Formula | C9H11ClF4N2 |
| Molecular Weight | 258.65 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 4-(2-amino-3,3,3-trifluoropropyl)-2-fluoroaniline;hydrochloride |
| SMILES | Cl.Nc1ccc(CC(N)C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H10F4N2.ClH/c10-6-3-5(1-2-7(6)14)4-8(15)9(11,12)13;/h1-3,8H,4,14-15H2;1H |
| InChIKey | NTLKRSWLFLKUKH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.65 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|