C12H14ClN5 — CID 168973381
1-chloro-N-[(3R)-piperidin-3-yl]pyrido[3,4-d]pyridazin-4-amine (PubChem CID 168973381) has the molecular formula C12H14ClN5 and a molecular weight of 263.73 g/mol. Its IUPAC name is 1-chloro-N-[(3R)-piperidin-3-yl]pyrido[3,4-d]pyridazin-4-amine.
| Compound Name | 1-chloro-N-[(3R)-piperidin-3-yl]pyrido[3,4-d]pyridazin-4-amine |
|---|---|
| PubChem CID | 168973381 |
| Molecular Formula | C12H14ClN5 |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-chloro-N-[(3R)-piperidin-3-yl]pyrido[3,4-d]pyridazin-4-amine |
| SMILES | Clc1nnc(N[C@@H]2CCCNC2)c2cnccc12 |
| InChI | InChI=1S/C12H14ClN5/c13-11-9-3-5-15-7-10(9)12(18-17-11)16-8-2-1-4-14-6-8/h3,5,7-8,14H,1-2,4,6H2,(H,16,18)/t8-/m1/s1 |
| InChIKey | KVJWCBCTEHZLCM-MRVPVSSYSA-N |
| XLogP | 1.84 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |