About 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride
4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride (PubChem CID 171837818) has the molecular formula C11H16Cl2N4O
and a molecular weight of 291.18 g/mol. Its IUPAC name is 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride |
| PubChem CID | 171837818 |
| Molecular Formula | C11H16Cl2N4O |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride |
| SMILES | Cl.Clc1nnc(N[C@@H]2CCCNC2)c2c1COC2 |
| InChI | InChI=1S/C11H15ClN4O.ClH/c12-10-8-5-17-6-9(8)11(16-15-10)14-7-2-1-3-13-4-7;/h7,13H,1-6H2,(H,14,16);1H/t7-;/m1./s1 |
| InChIKey | SXMPIPGXIZKVPB-OGFXRTJISA-N |
| XLogP | 1.75 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride?
The IUPAC name of 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride (CID 171837818) is 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride.
What is the SMILES notation for 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride?
The canonical SMILES for 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride is Cl.Clc1nnc(N[C@@H]2CCCNC2)c2c1COC2.
What is the InChIKey of 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride?
The InChIKey is SXMPIPGXIZKVPB-OGFXRTJISA-N. The full InChI is InChI=1S/C11H15ClN4O.ClH/c12-10-8-5-17-6-9(8)11(16-15-10)14-7-2-1-3-13-4-7;/h7,13H,1-6H2,(H,14,16);1H/t7-;/m1./s1.
What are the key properties of 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride?
4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride has a molecular weight of 291.18 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine;hydrochloride is sourced from PubChem (CID 171837818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).