About 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol
3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol (PubChem CID 167138133) has the molecular formula C11H14ClN3O2
and a molecular weight of 255.70 g/mol. Its IUPAC name is 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol |
| PubChem CID | 167138133 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol |
| SMILES | CC1(O)CC(Nc2nnc(Cl)c3c2COC3)C1 |
| InChI | InChI=1S/C11H14ClN3O2/c1-11(16)2-6(3-11)13-10-8-5-17-4-7(8)9(12)14-15-10/h6,16H,2-5H2,1H3,(H,13,15) |
| InChIKey | HCHIDCGAYHLUID-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol?
The IUPAC name of 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol (CID 167138133) is 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol.
What is the SMILES notation for 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol?
The canonical SMILES for 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol is CC1(O)CC(Nc2nnc(Cl)c3c2COC3)C1.
What is the InChIKey of 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol?
The InChIKey is HCHIDCGAYHLUID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN3O2/c1-11(16)2-6(3-11)13-10-8-5-17-4-7(8)9(12)14-15-10/h6,16H,2-5H2,1H3,(H,13,15).
What are the key properties of 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol?
3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol has a molecular weight of 255.70 g/mol, XLogP of 1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-yl)amino]-1-methylcyclobutan-1-ol is sourced from PubChem (CID 167138133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).