C22H28N2O2 — CID 168974099
1-(2,5-dimethylphenyl)-3-[3-(4-methoxyphenyl)cyclohexyl]urea (PubChem CID 168974099) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[3-(4-methoxyphenyl)cyclohexyl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[3-(4-methoxyphenyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 168974099 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[3-(4-methoxyphenyl)cyclohexyl]urea |
| SMILES | COc1ccc(C2CCCC(NC(=O)Nc3cc(C)ccc3C)C2)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-15-7-8-16(2)21(13-15)24-22(25)23-19-6-4-5-18(14-19)17-9-11-20(26-3)12-10-17/h7-13,18-19H,4-6,14H2,1-3H3,(H2,23,24,25) |
| InChIKey | RMDOBGNJOLGOIX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |