C23H29F2N3O4 — CID 168975048
1-[6-(3,3-difluorobutyl)-3-[4-(2-methoxyethoxy)phenyl]pyrazin-2-yl]piperidine-4-carboxylic acid (PubChem CID 168975048) has the molecular formula C23H29F2N3O4 and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-[6-(3,3-difluorobutyl)-3-[4-(2-methoxyethoxy)phenyl]pyrazin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-(3,3-difluorobutyl)-3-[4-(2-methoxyethoxy)phenyl]pyrazin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 168975048 |
| Molecular Formula | C23H29F2N3O4 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-[6-(3,3-difluorobutyl)-3-[4-(2-methoxyethoxy)phenyl]pyrazin-2-yl]piperidine-4-carboxylic acid |
| SMILES | COCCOc1ccc(-c2ncc(CCC(C)(F)F)nc2N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C23H29F2N3O4/c1-23(24,25)10-7-18-15-26-20(16-3-5-19(6-4-16)32-14-13-31-2)21(27-18)28-11-8-17(9-12-28)22(29)30/h3-6,15,17H,7-14H2,1-2H3,(H,29,30) |
| InChIKey | UVIRTKYOGDWKMG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|