C22H24FN3O4 — CID 168975113
1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(3-methoxypropyl)pyrazin-2-yl]piperidine-4-carboxylic acid (PubChem CID 168975113) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(3-methoxypropyl)pyrazin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(3-methoxypropyl)pyrazin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 168975113 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(3-methoxypropyl)pyrazin-2-yl]piperidine-4-carboxylic acid |
| SMILES | COCCCc1cnc(-c2cc(F)c3occc3c2)c(N2CCC(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C22H24FN3O4/c1-29-9-2-3-17-13-24-19(16-11-15-6-10-30-20(15)18(23)12-16)21(25-17)26-7-4-14(5-8-26)22(27)28/h6,10-14H,2-5,7-9H2,1H3,(H,27,28) |
| InChIKey | RNAHDITXCZNZPE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|