C21H25N5O3 — CID 168974863
1-[3-imidazo[1,5-a]pyridin-6-yl-6-(3-methoxypropyl)pyrazin-2-yl]piperidine-4-carboxylic acid (PubChem CID 168974863) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[3-imidazo[1,5-a]pyridin-6-yl-6-(3-methoxypropyl)pyrazin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-imidazo[1,5-a]pyridin-6-yl-6-(3-methoxypropyl)pyrazin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 168974863 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-[3-imidazo[1,5-a]pyridin-6-yl-6-(3-methoxypropyl)pyrazin-2-yl]piperidine-4-carboxylic acid |
| SMILES | COCCCc1cnc(-c2ccc3cncn3c2)c(N2CCC(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C21H25N5O3/c1-29-10-2-3-17-11-23-19(16-4-5-18-12-22-14-26(18)13-16)20(24-17)25-8-6-15(7-9-25)21(27)28/h4-5,11-15H,2-3,6-10H2,1H3,(H,27,28) |
| InChIKey | HVHKLTZDLUMTRB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|