C23H24N2 — CID 168977250
2-cycloheptyl-6-(cyclooctatetraenyl)-1,8-naphthyridine (PubChem CID 168977250) has the molecular formula C23H24N2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-cycloheptyl-6-(cyclooctatetraenyl)-1,8-naphthyridine.
| Compound Name | 2-cycloheptyl-6-(cyclooctatetraenyl)-1,8-naphthyridine |
|---|---|
| PubChem CID | 168977250 |
| Molecular Formula | C23H24N2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-cycloheptyl-6-(cyclooctatetraenyl)-1,8-naphthyridine |
| SMILES | C1=C\C=C/C(c2cnc3nc(C4CCCCCC4)ccc3c2)=C\C=C/1 |
| InChI | InChI=1S/C23H24N2/c1-2-6-10-18(11-7-3-1)21-16-20-14-15-22(25-23(20)24-17-21)19-12-8-4-5-9-13-19/h1-3,6-7,10-11,14-17,19H,4-5,8-9,12-13H2/b2-1-,3-1-,6-2-,7-3-,10-6-,11-7-,18-10+,18-11+ |
| InChIKey | XRUQVLQGJBDDCE-LAIAEXMQSA-N |
| XLogP | 6.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |