C31H46N6O6S — CID 168983479
[3-[5-[2-(2-amino-3-hydrazinyl-3-oxopropyl)-1,1-dioxo-1,4-thiazinan-4-yl]-1-ethyl-2-[2-(1-methoxyethyl)-3-pyridinyl]-2,3-dihydroindol-3-yl]-2,2-dimethylpropyl] formate (PubChem CID 168983479) has the molecular formula C31H46N6O6S and a molecular weight of 630.81 g/mol. Its IUPAC name is [3-[5-[2-(2-amino-3-hydrazinyl-3-oxopropyl)-1,1-dioxo-1,4-thiazinan-4-yl]-1-ethyl-2-[2-(1-methoxyethyl)-3-pyridinyl]-2,3-dihydroindol-3-yl]-2,2-dimethylpropyl] formate.
| Compound Name | [3-[5-[2-(2-amino-3-hydrazinyl-3-oxopropyl)-1,1-dioxo-1,4-thiazinan-4-yl]-1-ethyl-2-[2-(1-methoxyethyl)-3-pyridinyl]-2,3-dihydroindol-3-yl]-2,2-dimethylpropyl] formate |
|---|---|
| PubChem CID | 168983479 |
| Molecular Formula | C31H46N6O6S |
| Molecular Weight | 630.81 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | [3-[5-[2-(2-amino-3-hydrazinyl-3-oxopropyl)-1,1-dioxo-1,4-thiazinan-4-yl]-1-ethyl-2-[2-(1-methoxyethyl)-3-pyridinyl]-2,3-dihydroindol-3-yl]-2,2-dimethylpropyl] formate |
| SMILES | CCN1c2ccc(N3CCS(=O)(=O)C(CC(N)C(=O)NN)C3)cc2C(CC(C)(C)COC=O)C1c1cccnc1C(C)OC |
| InChI | InChI=1S/C31H46N6O6S/c1-6-37-27-10-9-21(36-12-13-44(40,41)22(17-36)15-26(32)30(39)35-33)14-24(27)25(16-31(3,4)18-43-19-38)29(37)23-8-7-11-34-28(23)20(2)42-5/h7-11,14,19-20,22,25-26,29H,6,12-13,15-18,32-33H2,1-5H3,(H,35,39) |
| InChIKey | HTUGNCUZNQXTBS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|