C15H20BrNO2 — CID 168984988
(3aR,6aS)-5-[2-(4-bromo-3-methylphenoxy)ethyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 168984988) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is (3aR,6aS)-5-[2-(4-bromo-3-methylphenoxy)ethyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-[2-(4-bromo-3-methylphenoxy)ethyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 168984988 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (3aR,6aS)-5-[2-(4-bromo-3-methylphenoxy)ethyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | Cc1cc(OCCN2C[C@H]3COC[C@H]3C2)ccc1Br |
| InChI | InChI=1S/C15H20BrNO2/c1-11-6-14(2-3-15(11)16)19-5-4-17-7-12-9-18-10-13(12)8-17/h2-3,6,12-13H,4-5,7-10H2,1H3/t12-,13+ |
| InChIKey | IPANRPZQMAKPMS-BETUJISGSA-N |
| XLogP | 2.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |