C25H33N2NaO — CID 168985612
sodium;7-(diethylamino)-4-(phenylmethylamino)-1H-naphthalen-2-one;2-methylpropane (PubChem CID 168985612) has the molecular formula C25H33N2NaO and a molecular weight of 400.54 g/mol. Its IUPAC name is sodium;7-(diethylamino)-4-(phenylmethylamino)-1H-naphthalen-2-one;2-methylpropane.
| Compound Name | sodium;7-(diethylamino)-4-(phenylmethylamino)-1H-naphthalen-2-one;2-methylpropane |
|---|---|
| PubChem CID | 168985612 |
| Molecular Formula | C25H33N2NaO |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | sodium;7-(diethylamino)-4-(phenylmethylamino)-1H-naphthalen-2-one;2-methylpropane |
| SMILES | CC(C)C.CCN(CC)c1ccc2c(c1)CC(=O)C=C2NCc1[c-]cccc1.[Na+] |
| InChI | InChI=1S/C21H23N2O.C4H10.Na/c1-3-23(4-2)18-10-11-20-17(12-18)13-19(24)14-21(20)22-15-16-8-6-5-7-9-16;1-4(2)3;/h5-8,10-12,14,22H,3-4,13,15H2,1-2H3;4H,1-3H3;/q-1;;+1 |
| InChIKey | CIIGXYUQQBGRJY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|