C11H20BO2 — CID 168987275
CID 168987275 (PubChem CID 168987275) has the molecular formula C11H20BO2 and a molecular weight of 195.09 g/mol.
| Compound Name | CID 168987275 |
|---|---|
| PubChem CID | 168987275 |
| Molecular Formula | C11H20BO2 |
| Molecular Weight | 195.09 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | — |
| SMILES | CC.CC1(C)C2CC3O[B]OC3C1C2 |
| InChI | InChI=1S/C9H14BO2.C2H6/c1-9(2)5-3-6(9)8-7(4-5)11-10-12-8;1-2/h5-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | AWZWGODRUYKKPN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|