C12H21BO2 — CID 140821917
9,9-dimethyl-4-propan-2-yl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 140821917) has the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. Its IUPAC name is 9,9-dimethyl-4-propan-2-yl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | 9,9-dimethyl-4-propan-2-yl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 140821917 |
| Molecular Formula | C12H21BO2 |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 9,9-dimethyl-4-propan-2-yl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC(C)B1OC2CC3CC(C2O1)C3(C)C |
| InChI | InChI=1S/C12H21BO2/c1-7(2)13-14-10-6-8-5-9(11(10)15-13)12(8,3)4/h7-11H,5-6H2,1-4H3 |
| InChIKey | GMZKLKOMQUEBSL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|