C8H17BO2 — CID 71411168
(4S,6S)-4,6-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane (PubChem CID 71411168) has the molecular formula C8H17BO2 and a molecular weight of 156.03 g/mol. Its IUPAC name is (4S,6S)-4,6-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane.
| Compound Name | (4S,6S)-4,6-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 71411168 |
| Molecular Formula | C8H17BO2 |
| Molecular Weight | 156.03 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (4S,6S)-4,6-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
| SMILES | CC(C)B1O[C@@H](C)C[C@H](C)O1 |
| InChI | InChI=1S/C8H17BO2/c1-6(2)9-10-7(3)5-8(4)11-9/h6-8H,5H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | ZVNUEIJUBFMMJA-YUMQZZPRSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.03 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|