C12H26B2O3 — CID 581619
dipropyl-[(2-propyl-1,3,2-dioxaborinan-5-yl)oxy]borane (PubChem CID 581619) has the molecular formula C12H26B2O3 and a molecular weight of 239.96 g/mol. Its IUPAC name is dipropyl-[(2-propyl-1,3,2-dioxaborinan-5-yl)oxy]borane.
| Compound Name | dipropyl-[(2-propyl-1,3,2-dioxaborinan-5-yl)oxy]borane |
|---|---|
| PubChem CID | 581619 |
| Molecular Formula | C12H26B2O3 |
| Molecular Weight | 239.96 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | dipropyl-[(2-propyl-1,3,2-dioxaborinan-5-yl)oxy]borane |
| SMILES | CCCB(CCC)OC1COB(CCC)OC1 |
| InChI | InChI=1S/C12H26B2O3/c1-4-7-13(8-5-2)17-12-10-15-14(9-6-3)16-11-12/h12H,4-11H2,1-3H3 |
| InChIKey | XROFRSYEFJJXQN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.96 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|