C10H22B2O3 — CID 535187
diethyl-[(2-ethyl-1,3,2-dioxaborinan-4-yl)methoxy]borane (PubChem CID 535187) has the molecular formula C10H22B2O3 and a molecular weight of 211.91 g/mol. Its IUPAC name is diethyl-[(2-ethyl-1,3,2-dioxaborinan-4-yl)methoxy]borane.
| Compound Name | diethyl-[(2-ethyl-1,3,2-dioxaborinan-4-yl)methoxy]borane |
|---|---|
| PubChem CID | 535187 |
| Molecular Formula | C10H22B2O3 |
| Molecular Weight | 211.91 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | diethyl-[(2-ethyl-1,3,2-dioxaborinan-4-yl)methoxy]borane |
| SMILES | CCB(CC)OCC1CCOB(CC)O1 |
| InChI | InChI=1S/C10H22B2O3/c1-4-11(5-2)14-9-10-7-8-13-12(6-3)15-10/h10H,4-9H2,1-3H3 |
| InChIKey | FOHBUYKFFMABPP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.91 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|