C8H16B2O4 — CID 567388
2,6-diethyl-4,4a,8,8a-tetrahydro-[1,3,2]dioxaborinino[5,4-d][1,3,2]dioxaborinine (PubChem CID 567388) has the molecular formula C8H16B2O4 and a molecular weight of 197.84 g/mol. Its IUPAC name is 2,6-diethyl-4,4a,8,8a-tetrahydro-[1,3,2]dioxaborinino[5,4-d][1,3,2]dioxaborinine.
| Compound Name | 2,6-diethyl-4,4a,8,8a-tetrahydro-[1,3,2]dioxaborinino[5,4-d][1,3,2]dioxaborinine |
|---|---|
| PubChem CID | 567388 |
| Molecular Formula | C8H16B2O4 |
| Molecular Weight | 197.84 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2,6-diethyl-4,4a,8,8a-tetrahydro-[1,3,2]dioxaborinino[5,4-d][1,3,2]dioxaborinine |
| SMILES | CCB1OCC2OB(CC)OCC2O1 |
| InChI | InChI=1S/C8H16B2O4/c1-3-9-11-5-8-7(13-9)6-12-10(4-2)14-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | LBPGFAWKXAXSEF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.84 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|