C8H16B2O6 — CID 153035584
2-[2-(1,3,2-dioxaborolan-2-yloxy)propoxy]-1,3,2-dioxaborinane (PubChem CID 153035584) has the molecular formula C8H16B2O6 and a molecular weight of 229.83 g/mol. Its IUPAC name is 2-[2-(1,3,2-dioxaborolan-2-yloxy)propoxy]-1,3,2-dioxaborinane.
| Compound Name | 2-[2-(1,3,2-dioxaborolan-2-yloxy)propoxy]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 153035584 |
| Molecular Formula | C8H16B2O6 |
| Molecular Weight | 229.83 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-[2-(1,3,2-dioxaborolan-2-yloxy)propoxy]-1,3,2-dioxaborinane |
| SMILES | CC(COB1OCCCO1)OB1OCCO1 |
| InChI | InChI=1S/C8H16B2O6/c1-8(16-10-13-5-6-14-10)7-15-9-11-3-2-4-12-9/h8H,2-7H2,1H3 |
| InChIKey | VERFIAKGOBTRFP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.83 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|