C17H23N3O3 — CID 168989699
(2S)-2-(4-aminobutyl)-6-(1,3-benzodioxol-5-yl)-4,5-dimethyl-2,5-dihydropyrazin-3-one (PubChem CID 168989699) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S)-2-(4-aminobutyl)-6-(1,3-benzodioxol-5-yl)-4,5-dimethyl-2,5-dihydropyrazin-3-one.
| Compound Name | (2S)-2-(4-aminobutyl)-6-(1,3-benzodioxol-5-yl)-4,5-dimethyl-2,5-dihydropyrazin-3-one |
|---|---|
| PubChem CID | 168989699 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S)-2-(4-aminobutyl)-6-(1,3-benzodioxol-5-yl)-4,5-dimethyl-2,5-dihydropyrazin-3-one |
| SMILES | CC1C(c2ccc3c(c2)OCO3)=N[C@@H](CCCCN)C(=O)N1C |
| InChI | InChI=1S/C17H23N3O3/c1-11-16(12-6-7-14-15(9-12)23-10-22-14)19-13(5-3-4-8-18)17(21)20(11)2/h6-7,9,11,13H,3-5,8,10,18H2,1-2H3/t11?,13-/m0/s1 |
| InChIKey | FHQZOPLLVJATIR-YUZLPWPTSA-N |
| XLogP | 1.56 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|