C25H28N4O4 — CID 168991716
1-[6-[2-amino-4-(2-morpholin-4-ylethoxy)anilino]-2-phenoxy-3-pyridinyl]ethanone (PubChem CID 168991716) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-[6-[2-amino-4-(2-morpholin-4-ylethoxy)anilino]-2-phenoxy-3-pyridinyl]ethanone.
| Compound Name | 1-[6-[2-amino-4-(2-morpholin-4-ylethoxy)anilino]-2-phenoxy-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 168991716 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[6-[2-amino-4-(2-morpholin-4-ylethoxy)anilino]-2-phenoxy-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2ccc(OCCN3CCOCC3)cc2N)nc1Oc1ccccc1 |
| InChI | InChI=1S/C25H28N4O4/c1-18(30)21-8-10-24(28-25(21)33-19-5-3-2-4-6-19)27-23-9-7-20(17-22(23)26)32-16-13-29-11-14-31-15-12-29/h2-10,17H,11-16,26H2,1H3,(H,27,28) |
| InChIKey | IVYLCQTZIFEILM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|