C12H25N — CID 168995443
ethane;5-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydrocyclohepta[b]pyrrole (PubChem CID 168995443) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is ethane;5-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydrocyclohepta[b]pyrrole.
| Compound Name | ethane;5-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydrocyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 168995443 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | ethane;5-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydrocyclohepta[b]pyrrole |
| SMILES | CC.CC1CCCC2NCCC2C1 |
| InChI | InChI=1S/C10H19N.C2H6/c1-8-3-2-4-10-9(7-8)5-6-11-10;1-2/h8-11H,2-7H2,1H3;1-2H3 |
| InChIKey | SIJBDQPBTBHZJQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |