C10H20ClN — CID 155858923
6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;hydrochloride (PubChem CID 155858923) has the molecular formula C10H20ClN and a molecular weight of 189.73 g/mol. Its IUPAC name is 6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;hydrochloride.
| Compound Name | 6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 155858923 |
| Molecular Formula | C10H20ClN |
| Molecular Weight | 189.73 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;hydrochloride |
| SMILES | CC1CCC2NCCCC2C1.Cl |
| InChI | InChI=1S/C10H19N.ClH/c1-8-4-5-10-9(7-8)3-2-6-11-10;/h8-11H,2-7H2,1H3;1H |
| InChIKey | CDGUHENIXPFPJW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |