C9H18N2 — CID 95396663
(4aS,6R,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-6-amine (PubChem CID 95396663) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (4aS,6R,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-6-amine.
| Compound Name | (4aS,6R,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-6-amine |
|---|---|
| PubChem CID | 95396663 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (4aS,6R,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-6-amine |
| SMILES | N[C@@H]1CC[C@@H]2NCCC[C@H]2C1 |
| InChI | InChI=1S/C9H18N2/c10-8-3-4-9-7(6-8)2-1-5-11-9/h7-9,11H,1-6,10H2/t7-,8+,9-/m0/s1 |
| InChIKey | JZFOPNSQKQOMJZ-YIZRAAEISA-N |
| XLogP | 0.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |