C11H23NO — CID 168995573
ethane;1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-7-ol (PubChem CID 168995573) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is ethane;1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-7-ol.
| Compound Name | ethane;1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-7-ol |
|---|---|
| PubChem CID | 168995573 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | ethane;1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-7-ol |
| SMILES | CC.CN1CCC2CCCC(O)C21 |
| InChI | InChI=1S/C9H17NO.C2H6/c1-10-6-5-7-3-2-4-8(11)9(7)10;1-2/h7-9,11H,2-6H2,1H3;1-2H3 |
| InChIKey | XPRQHRLUGNZEAH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |