C12H17ClN4O — CID 171553501
(3aS,7R,7aR)-1-(6-chloro-5-methyl-1,2,4-triazin-3-yl)-2,3,3a,4,5,6,7,7a-octahydroindol-7-ol (PubChem CID 171553501) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is (3aS,7R,7aR)-1-(6-chloro-5-methyl-1,2,4-triazin-3-yl)-2,3,3a,4,5,6,7,7a-octahydroindol-7-ol.
| Compound Name | (3aS,7R,7aR)-1-(6-chloro-5-methyl-1,2,4-triazin-3-yl)-2,3,3a,4,5,6,7,7a-octahydroindol-7-ol |
|---|---|
| PubChem CID | 171553501 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (3aS,7R,7aR)-1-(6-chloro-5-methyl-1,2,4-triazin-3-yl)-2,3,3a,4,5,6,7,7a-octahydroindol-7-ol |
| SMILES | Cc1nc(N2CC[C@@H]3CCC[C@@H](O)[C@@H]32)nnc1Cl |
| InChI | InChI=1S/C12H17ClN4O/c1-7-11(13)15-16-12(14-7)17-6-5-8-3-2-4-9(18)10(8)17/h8-10,18H,2-6H2,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | CVGQCTKYADCHQR-IVZWLZJFSA-N |
| XLogP | 1.57 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |