C31H41KNO3- — CID 168997579
potassium;1-(4-butoxy-2-ethylphenyl)-2-methylpropan-1-one;3-[4-(oxomethyl)heptan-4-yl]benzene-4-ide-1-carbonitrile (PubChem CID 168997579) has the molecular formula C31H41KNO3- and a molecular weight of 514.77 g/mol. Its IUPAC name is potassium;1-(4-butoxy-2-ethylphenyl)-2-methylpropan-1-one;3-[4-(oxomethyl)heptan-4-yl]benzene-4-ide-1-carbonitrile.
| Compound Name | potassium;1-(4-butoxy-2-ethylphenyl)-2-methylpropan-1-one;3-[4-(oxomethyl)heptan-4-yl]benzene-4-ide-1-carbonitrile |
|---|---|
| PubChem CID | 168997579 |
| Molecular Formula | C31H41KNO3- |
| Molecular Weight | 514.77 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | potassium;1-(4-butoxy-2-ethylphenyl)-2-methylpropan-1-one;3-[4-(oxomethyl)heptan-4-yl]benzene-4-ide-1-carbonitrile |
| SMILES | CCCC([C-]=O)(CCC)c1[c-]ccc(C#N)c1.CCCCOc1ccc(C(=O)C(C)C)c(CC)c1.[K+] |
| InChI | InChI=1S/C16H24O2.C15H17NO.K/c1-5-7-10-18-14-8-9-15(13(6-2)11-14)16(17)12(3)4;1-3-8-15(12-17,9-4-2)14-7-5-6-13(10-14)11-16;/h8-9,11-12H,5-7,10H2,1-4H3;5-6,10H,3-4,8-9H2,1-2H3;/q;-2;+1 |
| InChIKey | ZFLWZNVQAWNTPG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.77 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|