C26H28F2N6O2 — CID 168999184
2-(difluoromethyl)-7-[3-(5-ethyl-6-methoxy-3-pyridinyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-8,9-dimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one (PubChem CID 168999184) has the molecular formula C26H28F2N6O2 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-(difluoromethyl)-7-[3-(5-ethyl-6-methoxy-3-pyridinyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-8,9-dimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one.
| Compound Name | 2-(difluoromethyl)-7-[3-(5-ethyl-6-methoxy-3-pyridinyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-8,9-dimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
|---|---|
| PubChem CID | 168999184 |
| Molecular Formula | C26H28F2N6O2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 2-(difluoromethyl)-7-[3-(5-ethyl-6-methoxy-3-pyridinyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-8,9-dimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
| SMILES | CCc1cc(-c2cnc3c(c2)CN(C2Nn4c(nc(C(F)F)cc4=O)C(C)=C2C)CC3)cnc1OC |
| InChI | InChI=1S/C26H28F2N6O2/c1-5-16-8-17(12-30-26(16)36-4)18-9-19-13-33(7-6-20(19)29-11-18)25-15(3)14(2)24-31-21(23(27)28)10-22(35)34(24)32-25/h8-12,23,25,32H,5-7,13H2,1-4H3 |
| InChIKey | DFHDSWSPJXUWIG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |