C20H17N5OS — CID 169002175
4-[[4-(methylamino)thieno[3,2-d]pyrimidin-2-yl]amino]-N-phenylbenzamide (PubChem CID 169002175) has the molecular formula C20H17N5OS and a molecular weight of 375.46 g/mol. Its IUPAC name is 4-[[4-(methylamino)thieno[3,2-d]pyrimidin-2-yl]amino]-N-phenylbenzamide.
| Compound Name | 4-[[4-(methylamino)thieno[3,2-d]pyrimidin-2-yl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 169002175 |
| Molecular Formula | C20H17N5OS |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 4-[[4-(methylamino)thieno[3,2-d]pyrimidin-2-yl]amino]-N-phenylbenzamide |
| SMILES | CNc1nc(Nc2ccc(C(=O)Nc3ccccc3)cc2)nc2ccsc12 |
| InChI | InChI=1S/C20H17N5OS/c1-21-18-17-16(11-12-27-17)24-20(25-18)23-15-9-7-13(8-10-15)19(26)22-14-5-3-2-4-6-14/h2-12H,1H3,(H,22,26)(H2,21,23,24,25) |
| InChIKey | OMFVPVPCHBWRRQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |