C20H22F3N7O4 — CID 169003255
[1-hydroxy-2-[7-[(3R)-3-methylmorpholin-4-yl]-10-(1H-pyrazol-5-yl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl]ethyl] 2,2,2-trifluoroacetate (PubChem CID 169003255) has the molecular formula C20H22F3N7O4 and a molecular weight of 481.44 g/mol. Its IUPAC name is [1-hydroxy-2-[7-[(3R)-3-methylmorpholin-4-yl]-10-(1H-pyrazol-5-yl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl]ethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-hydroxy-2-[7-[(3R)-3-methylmorpholin-4-yl]-10-(1H-pyrazol-5-yl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl]ethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 169003255 |
| Molecular Formula | C20H22F3N7O4 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [1-hydroxy-2-[7-[(3R)-3-methylmorpholin-4-yl]-10-(1H-pyrazol-5-yl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl]ethyl] 2,2,2-trifluoroacetate |
| SMILES | C[C@@H]1COCCN1c1nc2c(cnn2-c2ccn[nH]2)c2c1CCN2CC(O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H22F3N7O4/c1-11-10-33-7-6-29(11)17-12-3-5-28(9-15(31)34-19(32)20(21,22)23)16(12)13-8-25-30(18(13)26-17)14-2-4-24-27-14/h2,4,8,11,15,31H,3,5-7,9-10H2,1H3,(H,24,27)/t11-,15?/m1/s1 |
| InChIKey | AENOGAZWUBKZCJ-ZRKZCGFPSA-N |
| XLogP | 1.16 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|