C19H23FN6O — CID 174179790
(3R)-4-[3-(2-fluoroethyl)-10-(2H-pyrrol-5-yl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-7-yl]-3-methylmorpholine (PubChem CID 174179790) has the molecular formula C19H23FN6O and a molecular weight of 370.43 g/mol. Its IUPAC name is (3R)-4-[3-(2-fluoroethyl)-10-(2H-pyrrol-5-yl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-7-yl]-3-methylmorpholine.
| Compound Name | (3R)-4-[3-(2-fluoroethyl)-10-(2H-pyrrol-5-yl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-7-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 174179790 |
| Molecular Formula | C19H23FN6O |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (3R)-4-[3-(2-fluoroethyl)-10-(2H-pyrrol-5-yl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-7-yl]-3-methylmorpholine |
| SMILES | C[C@@H]1COCCN1c1nc2c(cnn2C2=NCC=C2)c2c1CCN2CCF |
| InChI | InChI=1S/C19H23FN6O/c1-13-12-27-10-9-25(13)18-14-4-7-24(8-5-20)17(14)15-11-22-26(19(15)23-18)16-3-2-6-21-16/h2-3,11,13H,4-10,12H2,1H3/t13-/m1/s1 |
| InChIKey | HSBFYOBOMZLMLH-CYBMUJFWSA-N |
| XLogP | 1.80 |
| TPSA | 58.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |