C23H32F3N7O4SSi — CID 170680002
trimethyl-[2-[[3-[7-[(3R)-3-methylmorpholin-4-yl]-3-(trifluoromethylsulfonyl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-10-yl]pyrazol-1-yl]methoxy]ethyl]silane (PubChem CID 170680002) has the molecular formula C23H32F3N7O4SSi and a molecular weight of 587.70 g/mol. Its IUPAC name is trimethyl-[2-[[3-[7-[(3R)-3-methylmorpholin-4-yl]-3-(trifluoromethylsulfonyl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-10-yl]pyrazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-[7-[(3R)-3-methylmorpholin-4-yl]-3-(trifluoromethylsulfonyl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-10-yl]pyrazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 170680002 |
| Molecular Formula | C23H32F3N7O4SSi |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | trimethyl-[2-[[3-[7-[(3R)-3-methylmorpholin-4-yl]-3-(trifluoromethylsulfonyl)-3,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-10-yl]pyrazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[C@@H]1COCCN1c1nc2c(cnn2-c2ccn(COCC[Si](C)(C)C)n2)c2c1CCN2S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C23H32F3N7O4SSi/c1-16-14-36-10-9-31(16)21-17-5-8-32(38(34,35)23(24,25)26)20(17)18-13-27-33(22(18)28-21)19-6-7-30(29-19)15-37-11-12-39(2,3)4/h6-7,13,16H,5,8-12,14-15H2,1-4H3/t16-/m1/s1 |
| InChIKey | UVTOVLFPLUCLEN-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 107.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|