C60H91N3O7P+ — CID 169006227
tris[[1-[9-(4-ethylphenyl)nonanoyl]azetidin-3-yl]oxy]-hydroxyphosphanium (PubChem CID 169006227) has the molecular formula C60H91N3O7P+ and a molecular weight of 997.38 g/mol. Its IUPAC name is tris[[1-[9-(4-ethylphenyl)nonanoyl]azetidin-3-yl]oxy]-hydroxyphosphanium.
| Compound Name | tris[[1-[9-(4-ethylphenyl)nonanoyl]azetidin-3-yl]oxy]-hydroxyphosphanium |
|---|---|
| PubChem CID | 169006227 |
| Molecular Formula | C60H91N3O7P+ |
| Molecular Weight | 997.38 g/mol |
| Exact Mass | 996.66 |
| IUPAC Name | tris[[1-[9-(4-ethylphenyl)nonanoyl]azetidin-3-yl]oxy]-hydroxyphosphanium |
| SMILES | CCc1ccc(CCCCCCCCC(=O)N2CC(O[P+](O)(OC3CN(C(=O)CCCCCCCCc4ccc(CC)cc4)C3)OC3CN(C(=O)CCCCCCCCc4ccc(CC)cc4)C3)C2)cc1 |
| InChI | InChI=1S/C60H91N3O7P/c1-4-49-31-37-52(38-32-49)25-19-13-7-10-16-22-28-58(64)61-43-55(44-61)68-71(67,69-56-45-62(46-56)59(65)29-23-17-11-8-14-20-26-53-39-33-50(5-2)34-40-53)70-57-47-63(48-57)60(66)30-24-18-12-9-15-21-27-54-41-35-51(6-3)36-42-54/h31-42,55-57,67H,4-30,43-48H2,1-3H3/q+1 |
| InChIKey | HDDWLKXBKFLUAI-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.38 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|