C26H38N8 — CID 169007049
1-N'-[6-[[1,3-diamino-3-(4-methylphenyl)iminopropylidene]amino]hexyl]-3-N'-(4-methylphenyl)propanediimidamide (PubChem CID 169007049) has the molecular formula C26H38N8 and a molecular weight of 462.65 g/mol. Its IUPAC name is 1-N'-[6-[[1,3-diamino-3-(4-methylphenyl)iminopropylidene]amino]hexyl]-3-N'-(4-methylphenyl)propanediimidamide.
| Compound Name | 1-N'-[6-[[1,3-diamino-3-(4-methylphenyl)iminopropylidene]amino]hexyl]-3-N'-(4-methylphenyl)propanediimidamide |
|---|---|
| PubChem CID | 169007049 |
| Molecular Formula | C26H38N8 |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 1-N'-[6-[[1,3-diamino-3-(4-methylphenyl)iminopropylidene]amino]hexyl]-3-N'-(4-methylphenyl)propanediimidamide |
| SMILES | Cc1ccc(/N=C(\N)C/C(N)=N/CCCCCC/N=C(\N)C/C(N)=N/c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H38N8/c1-19-7-11-21(12-8-19)33-25(29)17-23(27)31-15-5-3-4-6-16-32-24(28)18-26(30)34-22-13-9-20(2)10-14-22/h7-14H,3-6,15-18H2,1-2H3,(H2,27,31)(H2,28,32)(H2,29,33)(H2,30,34) |
| InChIKey | BQZQDCBBYSWZTJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|