C24H24N4O — CID 169007857
2-(2-isocyanophenyl)-5-(4-methoxy-1,3-dihydroisoindol-2-yl)-3-methyl-4,5,6,7-tetrahydroindazole (PubChem CID 169007857) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-(2-isocyanophenyl)-5-(4-methoxy-1,3-dihydroisoindol-2-yl)-3-methyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 2-(2-isocyanophenyl)-5-(4-methoxy-1,3-dihydroisoindol-2-yl)-3-methyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 169007857 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-(2-isocyanophenyl)-5-(4-methoxy-1,3-dihydroisoindol-2-yl)-3-methyl-4,5,6,7-tetrahydroindazole |
| SMILES | [C-]#[N+]c1ccccc1-n1nc2c(c1C)CC(N1Cc3cccc(OC)c3C1)CC2 |
| InChI | InChI=1S/C24H24N4O/c1-16-19-13-18(27-14-17-7-6-10-24(29-3)20(17)15-27)11-12-21(19)26-28(16)23-9-5-4-8-22(23)25-2/h4-10,18H,11-15H2,1,3H3 |
| InChIKey | OLIHLNDWKQTUOO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|