C64H59BN3O6PS — CID 169008156
CID 169008156 (PubChem CID 169008156) has the molecular formula C64H59BN3O6PS and a molecular weight of 1040.04 g/mol.
| Compound Name | CID 169008156 |
|---|---|
| PubChem CID | 169008156 |
| Molecular Formula | C64H59BN3O6PS |
| Molecular Weight | 1040.04 g/mol |
| Exact Mass | 1039.40 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C(OP(OCC[N+]#[C-])N(C(C)C)C(C)C)[C@@H]1C/C=C/CCCCNC(=S)C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC |
| InChI | InChI=1S/C64H59BN3O6PS/c1-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-28-34-39-61(76)67-48-35-29-26-27-33-38-59-62(74-75(72-50-49-66-6)68(52(2)3)53(4)5)60(73-63(59)65)51-71-64(54-36-31-30-32-37-54,55-40-44-57(69-7)45-41-55)56-42-46-58(70-8)47-43-56/h27,30-33,36-37,40-47,52-53,59-60,62-63H,26,29,35,38,48-51H2,1-5,7-8H3,(H,67,76)/b33-27+/t59-,60+,62?,63+,75?/m0/s1 |
| InChIKey | UZQGLRRXLQQTSR-QXEGBUBNSA-N |
| XLogP | 9.28 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1040.04 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|