C15H26N4O2Sn — CID 169008754
tert-butyl 3-[(5-trimethylstannylpyrazin-2-yl)amino]azetidine-1-carboxylate (PubChem CID 169008754) has the molecular formula C15H26N4O2Sn and a molecular weight of 413.11 g/mol. Its IUPAC name is tert-butyl 3-[(5-trimethylstannylpyrazin-2-yl)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-trimethylstannylpyrazin-2-yl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 169008754 |
| Molecular Formula | C15H26N4O2Sn |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | tert-butyl 3-[(5-trimethylstannylpyrazin-2-yl)amino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2cnc([Sn](C)(C)C)cn2)C1 |
| InChI | InChI=1S/C12H17N4O2.3CH3.Sn/c1-12(2,3)18-11(17)16-7-9(8-16)15-10-6-13-4-5-14-10;;;;/h5-6,9H,7-8H2,1-3H3,(H,14,15);3*1H3; |
| InChIKey | CVKMHULPQNQSJM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |