C29H29NO3P+ — CID 169012695
triphenyl-[3-[2-(pyridine-3-carbonyloxy)ethoxy]propyl]phosphanium (PubChem CID 169012695) has the molecular formula C29H29NO3P+ and a molecular weight of 470.53 g/mol. Its IUPAC name is triphenyl-[3-[2-(pyridine-3-carbonyloxy)ethoxy]propyl]phosphanium.
| Compound Name | triphenyl-[3-[2-(pyridine-3-carbonyloxy)ethoxy]propyl]phosphanium |
|---|---|
| PubChem CID | 169012695 |
| Molecular Formula | C29H29NO3P+ |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | triphenyl-[3-[2-(pyridine-3-carbonyloxy)ethoxy]propyl]phosphanium |
| SMILES | O=C(OCCOCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C29H29NO3P/c31-29(25-12-10-19-30-24-25)33-22-21-32-20-11-23-34(26-13-4-1-5-14-26,27-15-6-2-7-16-27)28-17-8-3-9-18-28/h1-10,12-19,24H,11,20-23H2/q+1 |
| InChIKey | SFDDDOBNXBGSKU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|