C19H14ClF3N2O6S — CID 169015594
2-chloroethyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate (PubChem CID 169015594) has the molecular formula C19H14ClF3N2O6S and a molecular weight of 490.84 g/mol. Its IUPAC name is 2-chloroethyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate.
| Compound Name | 2-chloroethyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate |
|---|---|
| PubChem CID | 169015594 |
| Molecular Formula | C19H14ClF3N2O6S |
| Molecular Weight | 490.84 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 2-chloroethyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate |
| SMILES | CS(=O)(=O)c1cccc2c1c(=O)c(C(=O)OCCCl)nn2-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14ClF3N2O6S/c1-32(28,29)14-4-2-3-13-15(14)17(26)16(18(27)30-10-9-20)24-25(13)11-5-7-12(8-6-11)31-19(21,22)23/h2-8H,9-10H2,1H3 |
| InChIKey | XVBUPFDLAFCXHO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|