C24H25F3N2O6S — CID 166856637
heptyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate (PubChem CID 166856637) has the molecular formula C24H25F3N2O6S and a molecular weight of 526.53 g/mol. Its IUPAC name is heptyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate.
| Compound Name | heptyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate |
|---|---|
| PubChem CID | 166856637 |
| Molecular Formula | C24H25F3N2O6S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | heptyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate |
| SMILES | CCCCCCCOC(=O)c1nn(-c2ccc(OC(F)(F)F)cc2)c2cccc(S(C)(=O)=O)c2c1=O |
| InChI | InChI=1S/C24H25F3N2O6S/c1-3-4-5-6-7-15-34-23(31)21-22(30)20-18(9-8-10-19(20)36(2,32)33)29(28-21)16-11-13-17(14-12-16)35-24(25,26)27/h8-14H,3-7,15H2,1-2H3 |
| InChIKey | VDJLNDYXWRQTNV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|