C26H29F3N2O6S — CID 166856252
nonyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate (PubChem CID 166856252) has the molecular formula C26H29F3N2O6S and a molecular weight of 554.59 g/mol. Its IUPAC name is nonyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate.
| Compound Name | nonyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate |
|---|---|
| PubChem CID | 166856252 |
| Molecular Formula | C26H29F3N2O6S |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | nonyl 5-methylsulfonyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylate |
| SMILES | CCCCCCCCCOC(=O)c1nn(-c2ccc(OC(F)(F)F)cc2)c2cccc(S(C)(=O)=O)c2c1=O |
| InChI | InChI=1S/C26H29F3N2O6S/c1-3-4-5-6-7-8-9-17-36-25(33)23-24(32)22-20(11-10-12-21(22)38(2,34)35)31(30-23)18-13-15-19(16-14-18)37-26(27,28)29/h10-16H,3-9,17H2,1-2H3 |
| InChIKey | QLPLNOWQZMXSFZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|