C20H17F3N2O5S — CID 175394024
6-ethyl-5-ethylsulfinyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylic acid (PubChem CID 175394024) has the molecular formula C20H17F3N2O5S and a molecular weight of 454.43 g/mol. Its IUPAC name is 6-ethyl-5-ethylsulfinyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylic acid.
| Compound Name | 6-ethyl-5-ethylsulfinyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylic acid |
|---|---|
| PubChem CID | 175394024 |
| Molecular Formula | C20H17F3N2O5S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 6-ethyl-5-ethylsulfinyl-4-oxo-1-[4-(trifluoromethoxy)phenyl]cinnoline-3-carboxylic acid |
| SMILES | CCc1ccc2c(c1S(=O)CC)c(=O)c(C(=O)O)nn2-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N2O5S/c1-3-11-5-10-14-15(18(11)31(29)4-2)17(26)16(19(27)28)24-25(14)12-6-8-13(9-7-12)30-20(21,22)23/h5-10H,3-4H2,1-2H3,(H,27,28) |
| InChIKey | QOFJXPSVKLCYKM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |