C25H29NO2S — CID 169016937
9-[2-(2-methoxyethoxy)ethyl]-3-methyl-6-(3,4,5-trimethylthiophen-2-yl)carbazole (PubChem CID 169016937) has the molecular formula C25H29NO2S and a molecular weight of 407.58 g/mol. Its IUPAC name is 9-[2-(2-methoxyethoxy)ethyl]-3-methyl-6-(3,4,5-trimethylthiophen-2-yl)carbazole.
| Compound Name | 9-[2-(2-methoxyethoxy)ethyl]-3-methyl-6-(3,4,5-trimethylthiophen-2-yl)carbazole |
|---|---|
| PubChem CID | 169016937 |
| Molecular Formula | C25H29NO2S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 9-[2-(2-methoxyethoxy)ethyl]-3-methyl-6-(3,4,5-trimethylthiophen-2-yl)carbazole |
| SMILES | COCCOCCn1c2ccc(C)cc2c2cc(-c3sc(C)c(C)c3C)ccc21 |
| InChI | InChI=1S/C25H29NO2S/c1-16-6-8-23-21(14-16)22-15-20(25-18(3)17(2)19(4)29-25)7-9-24(22)26(23)10-11-28-13-12-27-5/h6-9,14-15H,10-13H2,1-5H3 |
| InChIKey | FDNXWHRXHXYWMY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|