C19H23N7O3S — CID 16902156
N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-4-nitrobenzamide (PubChem CID 16902156) has the molecular formula C19H23N7O3S and a molecular weight of 429.51 g/mol. Its IUPAC name is N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-4-nitrobenzamide.
| Compound Name | N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 16902156 |
| Molecular Formula | C19H23N7O3S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-4-nitrobenzamide |
| SMILES | CCSc1nc(NC(C)C)c2cnn(CCNC(=O)c3ccc([N+](=O)[O-])cc3)c2n1 |
| InChI | InChI=1S/C19H23N7O3S/c1-4-30-19-23-16(22-12(2)3)15-11-21-25(17(15)24-19)10-9-20-18(27)13-5-7-14(8-6-13)26(28)29/h5-8,11-12H,4,9-10H2,1-3H3,(H,20,27)(H,22,23,24) |
| InChIKey | XWSAGOOGIZJGHS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|