C16H25ClN6OS — CID 16902112
4-chloro-N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]butanamide (PubChem CID 16902112) has the molecular formula C16H25ClN6OS and a molecular weight of 384.94 g/mol. Its IUPAC name is 4-chloro-N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]butanamide.
| Compound Name | 4-chloro-N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 16902112 |
| Molecular Formula | C16H25ClN6OS |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-chloro-N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]butanamide |
| SMILES | CCSc1nc(NC(C)C)c2cnn(CCNC(=O)CCCCl)c2n1 |
| InChI | InChI=1S/C16H25ClN6OS/c1-4-25-16-21-14(20-11(2)3)12-10-19-23(15(12)22-16)9-8-18-13(24)6-5-7-17/h10-11H,4-9H2,1-3H3,(H,18,24)(H,20,21,22) |
| InChIKey | JXGUZTKLXJTWCE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|