C14H21ClN6OS — CID 16902110
2-chloro-N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide (PubChem CID 16902110) has the molecular formula C14H21ClN6OS and a molecular weight of 356.88 g/mol. Its IUPAC name is 2-chloro-N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16902110 |
| Molecular Formula | C14H21ClN6OS |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-chloro-N-[2-[6-ethylsulfanyl-4-(propan-2-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
| SMILES | CCSc1nc(NC(C)C)c2cnn(CCNC(=O)CCl)c2n1 |
| InChI | InChI=1S/C14H21ClN6OS/c1-4-23-14-19-12(18-9(2)3)10-8-17-21(13(10)20-14)6-5-16-11(22)7-15/h8-9H,4-7H2,1-3H3,(H,16,22)(H,18,19,20) |
| InChIKey | ZWOHOVMRIGCRDC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|