C26H28ClN3O2 — CID 169022600
2-chloro-4-[[8-(4-piperidin-4-ylbenzoyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzonitrile (PubChem CID 169022600) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is 2-chloro-4-[[8-(4-piperidin-4-ylbenzoyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzonitrile.
| Compound Name | 2-chloro-4-[[8-(4-piperidin-4-ylbenzoyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 169022600 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-chloro-4-[[8-(4-piperidin-4-ylbenzoyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzonitrile |
| SMILES | N#Cc1ccc(OC2CC3CCC(C2)N3C(=O)c2ccc(C3CCNCC3)cc2)cc1Cl |
| InChI | InChI=1S/C26H28ClN3O2/c27-25-15-23(8-5-20(25)16-28)32-24-13-21-6-7-22(14-24)30(21)26(31)19-3-1-17(2-4-19)18-9-11-29-12-10-18/h1-5,8,15,18,21-22,24,29H,6-7,9-14H2 |
| InChIKey | NWXNIKIGCYBOPI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |