C27H30FN3O3 — CID 169026798
3-[[cyclohexyl(methyl)amino]methyl]-4-[(E)-3-[5-fluoro-7-(methylamino)-1H-indol-3-yl]prop-2-enoyl]benzoic acid (PubChem CID 169026798) has the molecular formula C27H30FN3O3 and a molecular weight of 463.55 g/mol. Its IUPAC name is 3-[[cyclohexyl(methyl)amino]methyl]-4-[(E)-3-[5-fluoro-7-(methylamino)-1H-indol-3-yl]prop-2-enoyl]benzoic acid.
| Compound Name | 3-[[cyclohexyl(methyl)amino]methyl]-4-[(E)-3-[5-fluoro-7-(methylamino)-1H-indol-3-yl]prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 169026798 |
| Molecular Formula | C27H30FN3O3 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 3-[[cyclohexyl(methyl)amino]methyl]-4-[(E)-3-[5-fluoro-7-(methylamino)-1H-indol-3-yl]prop-2-enoyl]benzoic acid |
| SMILES | CNc1cc(F)cc2c(/C=C/C(=O)c3ccc(C(=O)O)cc3CN(C)C3CCCCC3)c[nH]c12 |
| InChI | InChI=1S/C27H30FN3O3/c1-29-24-14-20(28)13-23-18(15-30-26(23)24)9-11-25(32)22-10-8-17(27(33)34)12-19(22)16-31(2)21-6-4-3-5-7-21/h8-15,21,29-30H,3-7,16H2,1-2H3,(H,33,34)/b11-9+ |
| InChIKey | ZOCRWUNGVDGWDO-PKNBQFBNSA-N |
| XLogP | 5.71 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|