C15H20N8O4 — CID 169026874
N-[3-(2-methylidenebutanoylamino)-2-nitropropyl]-2-(1-methylpyrrol-2-yl)tetrazole-5-carboxamide (PubChem CID 169026874) has the molecular formula C15H20N8O4 and a molecular weight of 376.38 g/mol. Its IUPAC name is N-[3-(2-methylidenebutanoylamino)-2-nitropropyl]-2-(1-methylpyrrol-2-yl)tetrazole-5-carboxamide.
| Compound Name | N-[3-(2-methylidenebutanoylamino)-2-nitropropyl]-2-(1-methylpyrrol-2-yl)tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 169026874 |
| Molecular Formula | C15H20N8O4 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[3-(2-methylidenebutanoylamino)-2-nitropropyl]-2-(1-methylpyrrol-2-yl)tetrazole-5-carboxamide |
| SMILES | C=C(CC)C(=O)NCC(CNC(=O)c1nnn(-c2cccn2C)n1)[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N8O4/c1-4-10(2)14(24)16-8-11(23(26)27)9-17-15(25)13-18-20-22(19-13)12-6-5-7-21(12)3/h5-7,11H,2,4,8-9H2,1,3H3,(H,16,24)(H,17,25) |
| InChIKey | NPSIZXNVZANZRZ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|